For research use only. Not for therapeutic Use.
8-Bromo-1,2,3,4-tetrahydroisoquinoline(Cat No.:L039044)is a brominated heterocyclic compound that features a partially saturated isoquinoline structure. This compound is particularly valuable in pharmaceutical synthesis, serving as a versatile intermediate for creating a variety of alkaloid derivatives and complex organic molecules. The bromo group on the tetrahydroisoquinoline ring enhances its reactivity, making it suitable for nucleophilic substitution reactions that facilitate the synthesis of novel compounds with potential therapeutic properties. 8-Bromo-1,2,3,4-tetrahydroisoquinoline is often used in the development of drugs targeting neurological disorders due to its structural similarity to natural neuroactive alkaloids.
CAS Number | 75416-51-2 |
Molecular Formula | C9H10BrN |
Purity | ≥95% |
IUPAC Name | 8-bromo-1,2,3,4-tetrahydroisoquinoline |
InChI | InChI=1S/C9H10BrN/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-3,11H,4-6H2 |
InChIKey | KHWGHUZYXQPIKA-UHFFFAOYSA-N |
SMILES | C1CNCC2=C1C=CC=C2Br |