For research use only. Not for therapeutic Use.
8-Bromo-1,5-naphthyridine-3-carboxylic acid is a heterocyclic compound characterized by a bromine atom at the 8-position and a carboxylic acid group at the 3-position of a naphthyridine ring. This compound is significant in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. The bromine substitution enhances its reactivity, allowing for further functionalization. Its unique structure makes it a valuable scaffold for the development of novel therapeutic agents and for exploring new applications in drug discovery.
CAS Number | 2007916-63-2 |
Molecular Formula | C9H5BrN2O2 |
Purity | ≥95% |
IUPAC Name | 8-bromo-1,5-naphthyridine-3-carboxylic acid |
InChI | InChI=1S/C9H5BrN2O2/c10-6-1-2-11-7-3-5(9(13)14)4-12-8(6)7/h1-4H,(H,13,14) |
InChIKey | DERFPWWIVWOJBT-UHFFFAOYSA-N |
SMILES | C1=CN=C2C=C(C=NC2=C1Br)C(=O)O |