For research use only. Not for therapeutic Use.
8-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine is a specialized chemical compound commonly used in pharmaceutical and biochemical research. This heterocyclic molecule, featuring a bromine atom and a fused dioxino-pyridine structure, serves as a versatile intermediate in the synthesis of various bioactive compounds. It is particularly valuable in studies related to drug development, specifically in exploring molecular interactions and developing targeted therapies. Its unique structure makes it an important building block in medicinal chemistry applications.
Catalog Number | L032920 |
CAS Number | 643067-83-8 |
Molecular Formula | C7H6BrNO2 |
Purity | ≥95% |
IUPAC Name | 8-bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine |
InChI | InChI=1S/C7H6BrNO2/c8-5-1-2-9-7-6(5)10-3-4-11-7/h1-2H,3-4H2 |
InChIKey | NGHQXFDMTGXJAQ-UHFFFAOYSA-N |
SMILES | C1COC2=NC=CC(=C2O1)Br |