For research use only. Not for therapeutic Use.
8-Bromo-3-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine (Cat.No:L003937) is a vital compound in medicinal chemistry. Its unique imidazopyridine core, coupled with bromine, iodine, and trifluoromethyl groups, imparts distinctive pharmacological properties. This compound holds promise in the development of innovative pharmaceuticals, particularly in the field of targeted therapies.
CAS Number | 2384795-34-8 |
Molecular Formula | C8H3BrF3IN2 |
Purity | ≥95% |
IUPAC Name | 8-bromo-3-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
InChI | InChI=1S/C8H3BrF3IN2/c9-5-1-4(8(10,11)12)3-15-6(13)2-14-7(5)15/h1-3H |
InChIKey | LLXJUNMIVIACER-UHFFFAOYSA-N |
SMILES | C1=C(C2=NC=C(N2C=C1C(F)(F)F)I)Br |