For research use only. Not for therapeutic Use.
8-Bromo-6-fluoroisoquinoline(Cat No.:L007719), is a chemical compound with a heterocyclic structure containing bromine and fluorine atoms on an isoquinoline scaffold. This compound is valuable in medicinal chemistry and organic synthesis. Researchers use it as a key building block for the synthesis of various organic molecules, especially in the development of pharmaceuticals. Its applications include drug discovery, where it serves as a vital intermediate for potential therapeutic agents.
CAS Number | 1935199-41-9 |
Molecular Formula | C9H5BrFN |
Purity | ≥95% |
IUPAC Name | 8-bromo-6-fluoroisoquinoline |
InChI | InChI=1S/C9H5BrFN/c10-9-4-7(11)3-6-1-2-12-5-8(6)9/h1-5H |
InChIKey | HCZGXSHJAQARMI-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=C(C=C(C=C21)F)Br |