For research use only. Not for therapeutic Use.
8-Bromo-6-methoxy-tetralin-1-one(CAT: L000467) is a compound of interest in organic chemistry, particularly in the development of organic molecules with potential pharmaceutical applications. This compound serves as a key intermediate in the synthesis of various organic products, making it valuable in the field of medicinal chemistry and drug development. Its unique structure and reactivity play an important role in the creation of pharmaceutical intermediates, aiding the design and production of potential drug candidates with applications in the field of pharmaceutical chemistry.
CAS Number | 1336952-02-3 |
Molecular Formula | C11H11BrO2 |
Purity | ≥95% |
IUPAC Name | 8-bromo-6-methoxy-3,4-dihydro-2H-naphthalen-1-one |
InChI | InChI=1S/C11H11BrO2/c1-14-8-5-7-3-2-4-10(13)11(7)9(12)6-8/h5-6H,2-4H2,1H3 |
InChIKey | DTGKGALXLOFBAY-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |