For research use only. Not for therapeutic Use.
8-Bromo-6-methoxyisoquinoline(Cat No.:L024906)is a halogenated isoquinoline derivative featuring a bromine atom at the 8-position and a methoxy group at the 6-position. This compound is valuable in pharmaceutical research and organic synthesis as a key intermediate in the development of bioactive molecules, including potential anticancer and antimicrobial agents. The presence of the bromine atom allows for versatile functionalization through cross-coupling reactions, while the methoxy group enhances the compound’s reactivity. Its high purity ensures consistent performance in advanced medicinal chemistry and chemical synthesis applications.
CAS Number | 1220694-86-9 |
Molecular Formula | C10H8BrNO |
Purity | ≥95% |
IUPAC Name | 8-bromo-6-methoxyisoquinoline |
InChI | InChI=1S/C10H8BrNO/c1-13-8-4-7-2-3-12-6-9(7)10(11)5-8/h2-6H,1H3 |
InChIKey | KOPSDOQUXJXWBM-UHFFFAOYSA-N |
SMILES | COC1=CC(=C2C=NC=CC2=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |