For research use only. Not for therapeutic Use.
8-bromo-6-methyl-3,4-dihydro-2H-1-benzopyran-4-one(Cat No.:L007715), is a chemical compound with a fused benzopyran ring system containing a bromine atom, a methyl group, and a carbonyl group. This specific structure is significant in medicinal chemistry and organic synthesis. Researchers use it as a valuable intermediate in the synthesis of complex organic molecules, especially in pharmaceutical research. Its applications include drug discovery, where it serves as a key building block for the development of potential therapeutic agents.
CAS Number | 1026982-77-3 |
Molecular Formula | C10H9BrO2 |
Purity | ≥95% |
IUPAC Name | 8-bromo-6-methyl-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C10H9BrO2/c1-6-4-7-9(12)2-3-13-10(7)8(11)5-6/h4-5H,2-3H2,1H3 |
InChIKey | UXJVBNRUWGNFAQ-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C(=C1)Br)OCCC2=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |