For research use only. Not for therapeutic Use.
8-bromo-Cyclic AMP is a brominated derivative of cAMP that remains long-acting due to its resistance to degradation by cAMP phosphodiesterase. It can activate cAMP-dependent protein kinase, inhibiting growth, decreasing proliferation, increasing differentiation, and inducing apoptosis of cancer cells.
| Catalog Number | R065714 |
| CAS Number | 23583-48-4 |
| Synonyms | 8-Bromoadenosine 3/’,5/’-cyclic monophosphate;8-bromo-cAMP;NSC 171719 |
| Molecular Formula | C10H11BrN5O6P |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| Storage | -20°C |
| IUPAC Name | (4aR,6R,7R,7aS)-6-(6-amino-8-bromopurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| InChI | InChI=1S/C10H11BrN5O6P/c11-10-15-4-7(12)13-2-14-8(4)16(10)9-5(17)6-3(21-9)1-20-23(18,19)22-6/h2-3,5-6,9,17H,1H2,(H,18,19)(H2,12,13,14)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DVKQVRZMKBDMDH-UUOKFMHZSA-N |
| SMILES | C1C2C(C(C(O2)N3C4=C(C(=NC=N4)N)N=C3Br)O)OP(=O)(O1)O |
| Reference | 1.Schwede, F.,Maronde, F.,Genieser, H., et al. Cyclic nucleotide analogs as biochemical tools and prospective drugs. Pharmacology & Therapeutics 87(2), 199-226 (2000). |
