For research use only. Not for therapeutic Use.
8-Chloro-1,2,3,4-tetrahydroquinoline(CAT: L030670) is a high-purity heterocyclic compound widely utilized in pharmaceutical and organic chemistry research. Featuring a chlorine substituent at the 8-position of the tetrahydroquinoline scaffold, this compound offers unique reactivity and serves as a versatile building block in the synthesis of complex organic molecules. Its partially saturated quinoline structure makes it a valuable intermediate for the development of bioactive compounds, drugs, and materials. 8-Chloro-1,2,3,4-tetrahydroquinoline ensures reliable performance, stability, and adaptability, supporting innovative research applications in medicinal chemistry and advanced material development.
CAS Number | 90562-36-0 |
Molecular Formula | C9H10ClN |
Purity | ≥95% |
IUPAC Name | 8-chloro-1,2,3,4-tetrahydroquinoline |
InChI | InChI=1S/C9H10ClN/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1,3,5,11H,2,4,6H2 |
InChIKey | NLSDMOYGCYVCFC-UHFFFAOYSA-N |
SMILES | C1CC2=C(C(=CC=C2)Cl)NC1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |