For research use only. Not for therapeutic Use.
8-Chloro-5-methoxyisoquinoline(CAT: L000425) is a valuable compound primarily used in organic chemistry. This molecule serves as an important building block for the synthesis of various organic compounds and intermediates. Its unique structure, incorporating a chloro group and a methoxy group, allows for the modification and functionalization of organic molecules, making it a versatile tool for designing and producing novel compounds with tailored properties.
CAS Number | 1421600-95-4 |
Molecular Formula | C10H8ClNO |
Purity | ≥95% |
IUPAC Name | 8-chloro-5-methoxyisoquinoline |
InChI | InChI=1S/C10H8ClNO/c1-13-10-3-2-9(11)8-6-12-5-4-7(8)10/h2-6H,1H3 |
InChIKey | JPKITGFGPZTPLF-UHFFFAOYSA-N |