For research use only. Not for therapeutic Use.
8-Chloroquinolin-3-amine(Cat No.:L031310)is a valuable compound used in pharmaceutical and chemical research. Featuring a quinoline core with a chlorine atom at the 8-position and an amino group at the 3-position, this compound serves as a key intermediate in the synthesis of various bioactive molecules, including potential therapeutic agents. Its unique structure facilitates diverse chemical transformations, making it essential in medicinal chemistry for developing new drugs. This compound plays a crucial role in advancing research in drug discovery, particularly in exploring novel chemical pathways and biological activities.
CAS Number | 347146-21-8 |
Molecular Formula | C9H7ClN2 |
Purity | ≥95% |
IUPAC Name | 8-chloroquinolin-3-amine |
InChI | InChI=1S/C9H7ClN2/c10-8-3-1-2-6-4-7(11)5-12-9(6)8/h1-5H,11H2 |
InChIKey | AUEFQGAQNYYPQE-UHFFFAOYSA-N |
SMILES | C1=CC2=CC(=CN=C2C(=C1)Cl)N |