For research use only. Not for therapeutic Use.
8-Deschloro-8-bromo Desloratadine（Cat No.:C000135）, is a chemical compound related to desloratadine, which is an antihistamine used to relieve allergy symptoms like hay fever and hives. This compound represents a derivative of desloratadine with specific modifications, including the removal of a chlorine atom and the addition of a bromine atom. Such modifications can influence its pharmacological properties and potential efficacy in treating allergic reactions.
| Catalog Number | C000135 |
| CAS Number | 117796-50-6 |
| Synonyms | Desloratadine USP Related Compound A |
| Molecular Formula | C₁₉H₁₉BrN₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Off-White to Pale Brown Solid |
| Storage | 4°C |
| IUPAC Name | 13-bromo-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChI | InChI=1S/C19H19BrN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2 |
| InChIKey | VUXYWIBSPSRHON-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Br)C(=C3CCNCC3)C4=C1C=CC=N4 |
| Reference | Ramulu, G., et al.: Sci. Pharm 79, 277 (2011); Reddy, K. V. S. R. K., et al.: J Pharm Biomed Anal 32, 29 (2003) |
