For research use only. Not for therapeutic Use.
8-ethenyl-1,3,7-trimethylpurine-2,6-dione(CAT: M092935) is a caffeine derivative that can be prepared by Heck reaction of caffeine with halogenated alkenes. This product is used for organic synthesis, pharmaceutical research and development, and other scientific purposes.
Molecular Formula | C10H12N4O2 |
Purity | ≥95% |
IUPAC Name | 8-ethenyl-1,3,7-trimethylpurine-2,6-dione |
InChI | InChI=1S/C10H12N4O2/c1-5-6-11-8-7(12(6)2)9(15)14(4)10(16)13(8)3/h5H,1H2,2-4H3 |
InChIKey | AASSRPTYAALGJN-UHFFFAOYSA-N |
SMILES | CN1C(=NC2=C1C(=O)N(C(=O)N2C)C)C=C |