For research use only. Not for therapeutic Use.
8-Fluoroisoquinoline-4-carboxylic acid(Cat No.:L027580)is a fluorinated heterocyclic compound featuring an isoquinoline core with a carboxylic acid group at the 4-position and a fluorine atom at the 8-position. This structural arrangement enhances the molecule’s electronic properties and reactivity, making it a valuable intermediate in pharmaceutical synthesis. The presence of the fluorine atom increases metabolic stability and lipophilicity, which can improve the pharmacokinetic profiles of drug candidates derived from this compound. The carboxylic acid group allows for easy modification, facilitating the synthesis of a wide range of bioactive derivatives, particularly in the development of antitumor and antibacterial agents.
CAS Number | 1824276-14-3 |
Molecular Formula | C10H6FNO2 |
Purity | ≥95% |
IUPAC Name | 8-fluoroisoquinoline-4-carboxylic acid |
InChI | InChI=1S/C10H6FNO2/c11-9-3-1-2-6-7(9)4-12-5-8(6)10(13)14/h1-5H,(H,13,14) |
InChIKey | FHBNRTQVPCOTAZ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=NC=C2C(=C1)F)C(=O)O |