For research use only. Not for therapeutic Use.
8-(Fmoc-amino)-3,6-dioxaoctanoic Acid (Cat.No:R025534) is a chemical compound often used in peptide synthesis and solid-phase peptide synthesis (SPPS). The Fmoc group is a protecting group that helps in the stepwise assembly of peptides. This compound aids in the creation of peptide chains with specific sequences for various research and pharmaceutical applications.
CAS Number | 166108-71-0 |
Synonyms | Fmoc-AEEA; 12-(9H-Fluoren-9-yl)-10-oxo-3,6,11-trioxa-9-azadodecanoic Acid; 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10-trioxa-4-azadodecan-12-oic Acid; 8-(9-Fluorenylmethoxycarbonylamino)-3,6-dioxaoctanoic Acid; 9-Fluorenylmethoxycarbonyl-8-amin |
Molecular Formula | C21H23NO6 |
Purity | ≥95% |
Target | PROTAC |
Storage | -20°C |
IUPAC Name | 2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C21H23NO6/c23-20(24)14-27-12-11-26-10-9-22-21(25)28-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,19H,9-14H2,(H,22,25)(H,23,24) |
InChIKey | XQPYRJIMPDBGRW-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCC(=O)O |