Home
>
Chemical Reagents>Heterocyclic Building Blocks> 8-hydroxy-1,6-Naphthyridine-7-carboxylic acid
For research use only. Not for therapeutic Use.
8-Hydroxy-1,6-naphthyridine-7-carboxylic acid(Cat No.:L010358)is a heterocyclic compound featuring both hydroxyl and carboxylic acid functional groups on a naphthyridine scaffold. This compound is valuable in pharmaceutical research, particularly in the development of antibacterial and antiviral agents. Its structure allows for versatile chemical modifications, making it a useful intermediate in the synthesis of bioactive molecules. The hydroxyl group enhances its reactivity, while the carboxylic acid provides a handle for further functionalization. High purity and consistent quality make it essential for advanced medicinal chemistry and drug development applications.
CAS Number | 410542-70-0 |
Molecular Formula | C9H6N2O3 |
Purity | ≥95% |
IUPAC Name | 8-hydroxy-1,6-naphthyridine-7-carboxylic acid |
InChI | InChI=1S/C9H6N2O3/c12-8-6-5(2-1-3-10-6)4-11-7(8)9(13)14/h1-4,12H,(H,13,14) |
InChIKey | YKJPPGSOGMPOFH-UHFFFAOYSA-N |
SMILES | C1=CC2=CN=C(C(=C2N=C1)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |