For research use only. Not for therapeutic Use.
8-Hydroxyadenosine is a purine nucleoside[1].
| Catalog Number | I042661 |
| CAS Number | 29851-57-8 |
| Synonyms | 6-amino-9-[(2R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-purin-8-one |
| Molecular Formula | C10H13N5O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C10H13N5O5/c11-7-4-8(13-2-12-7)15(10(19)14-4)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H,14,19)(H2,11,12,13)/t3-,5+,6?,9-/m1/s1 |
| InChIKey | UEHOMUNTZPIBIL-ACJOCUEISA-N |
| SMILES | C1=NC(=C2C(=N1)N(C(=O)N2)C3C(C(C(O3)CO)O)O)N |
| Reference | [1]. Kanou M, et al. Purine 8-substitution modulates the ribonuclease L binding and activation abilities of 2′,5′-oligoadenylates. Biochem Biophys Res Commun. 1991 Apr 30;176(2):769-74. |
