For research use only. Not for therapeutic Use.
8-Hydroxyquinoline(Cat No.:I001818) is a monoprotic bidentate chelating agent that forms stable complexes with metal ions. It exhibits antiseptic, disinfectant, and pesticide properties due to its ability to chelate metal ions necessary for microbial growth and enzyme function. Additionally, 8-hydroxyquinoline functions as a transcription inhibitor, inhibiting RNA synthesis in certain organisms. Its diverse properties make it useful in various applications, including as an antiseptic in wound healing, a preservative in pharmaceuticals, and a pesticide in agricultural settings.
CAS Number | 148-24-3 |
Molecular Formula | C9H7NO |
Purity | ≥95% |
Target | Bacterial |
Solubility | 10 mM in DMSO |
Storage | Store at +4C |
IUPAC Name | quinolin-8-ol |
InChI | InChI=1S/C9H7NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H |
InChIKey | MCJGNVYPOGVAJF-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)O)N=CC=C2 |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |