For research use only. Not for therapeutic Use.
8-Hydroxyquinolinolato-lithium (Cat.No:M023750) is a chemical compound used in various applications, including organometallic chemistry and as a ligand in coordination chemistry. It forms stable complexes with metal ions, exhibiting versatile reactivity. Its unique structure lends itself to catalytic and synthetic processes, making it valuable in research and industrial contexts.
CAS Number | 850918-68-2 |
Synonyms | Liq;8-Hydroxyquinolinolato-lithium;8-Hydroxyquinolinola;Liq , 8-Hydroxyquinolinolato-lithiuM;8-hydroxyquinoline lithiuM;LithiuM 8-Hydroxyquinolinolate;4,4`-diamine |
Molecular Formula | C9H6LiNO |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | lithium;quinolin-8-olate |
InChI | InChI=1S/C9H7NO.Li/c11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-6,11H;/q;+1/p-1 |
InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-M |
SMILES | [Li+].C1=CC2=C(C(=C1)[O-])N=CC=C2 |