For research use only. Not for therapeutic Use.
8-iso Prostaglandin F2α-d4(Cat No.:R067213)is a deuterated compound featuring four deuterium atoms, essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of 8-iso Prostaglandin F2α is crucial for studying its pharmacokinetics, metabolic pathways, and role in oxidative stress and inflammation. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for mass spectrometry and NMR applications. With enhanced stability and consistency, 8-iso Prostaglandin F2α-d4 integrates seamlessly into various experimental setups, providing a robust solution for high-precision scientific investigations. Perfect for cardiovascular and inflammatory research, it supports cutting-edge studies in medicinal chemistry and biomarker analysis.
CAS Number | 211105-40-7 |
Synonyms | iPF2α-III-d4;8-Isoprostane-d4;15-F2t-Isoprostane-d4;8-epi PGF2α-d4 |
Molecular Formula | C20H30D4O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (Z)-3,3,4,4-tetradeuterio-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,21-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16-,17+,18-,19+/m0/s1/i5D2,8D2 |
InChIKey | PXGPLTODNUVGFL-FLRLWOSLSA-N |
SMILES | [2H]C([2H])(CC(=O)O)C([2H])([2H])/C=C\C[C@@H]1[C@H](C[C@H]([C@@H]1/C=C/[C@H](CCCCC)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |