Home
>
Chemical Reagents>Heterocyclic Building Blocks> 8-Methoxy-2-(trifluoromethyl)quinoline-5-carboxylic acid
For research use only. Not for therapeutic Use.
8-Methoxy-2-(trifluoromethyl)quinoline-5-carboxylic acid(Cat No.:L033541)is a fluorinated quinoline derivative widely used in pharmaceutical and chemical research. Featuring a quinoline core with a methoxy group at the 8-position, a trifluoromethyl group at the 2-position, and a carboxylic acid group at the 5-position, this compound serves as a crucial intermediate in the synthesis of bioactive molecules, particularly those with potential antimicrobial and anticancer properties. Its unique structure allows for diverse chemical modifications, making it valuable in the development of complex organic compounds and advanced therapeutic agents.
Catalog Number | L033541 |
CAS Number | 199872-29-2 |
Molecular Formula | C12H8F3NO3 |
Purity | ≥95% |
IUPAC Name | 8-methoxy-2-(trifluoromethyl)quinoline-5-carboxylic acid |
InChI | InChI=1S/C12H8F3NO3/c1-19-8-4-2-7(11(17)18)6-3-5-9(12(13,14)15)16-10(6)8/h2-5H,1H3,(H,17,18) |
InChIKey | WSFPCQOJBVMWEE-UHFFFAOYSA-N |
SMILES | COC1=C2C(=C(C=C1)C(=O)O)C=CC(=N2)C(F)(F)F |