For research use only. Not for therapeutic Use.
8-Methoxyquinoline-2-carboxylic Acid(Cat No.:L007098), is an organic compound used in chemical research and synthesis. It contains a quinoline core with a methoxy group (-OCH3) at the 8th position and a carboxylic acid group (-COOH) at the 2nd position. Compounds with quinoline scaffolds often possess biological activities, making them valuable in drug discovery efforts. Researchers utilize 8-methoxyquinoline-2-carboxylic acid as a building block to create novel molecules for potential pharmaceutical applications.
CAS Number | 21141-35-5 |
Molecular Formula | C11H9NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 8-methoxyquinoline-2-carboxylic acid |
InChI | InChI=1S/C11H9NO3/c1-15-9-4-2-3-7-5-6-8(11(13)14)12-10(7)9/h2-6H,1H3,(H,13,14) |
InChIKey | RAZRTJLTLNPWKV-UHFFFAOYSA-N |
SMILES | COC1=CC=CC2=C1N=C(C=C2)C(=O)O |