For research use only. Not for therapeutic Use.
8-Methoxyquinoline-6-carboxylic acid (Cat.No:L003592) is a significant compound in pharmaceutical research. Its unique structure incorporates a methoxy group and a carboxylic acid moiety, offering diverse reactivity. This compound serves as a key intermediate in the synthesis of specialized pharmaceutical agents, highlighting its importance in drug development processes.
Catalog Number | L003592 |
CAS Number | 1668584-26-6 |
Molecular Formula | C11H9NO3 |
Purity | ≥95% |
IUPAC Name | 8-methoxyquinoline-6-carboxylic acid |
InChI | InChI=1S/C11H9NO3/c1-15-9-6-8(11(13)14)5-7-3-2-4-12-10(7)9/h2-6H,1H3,(H,13,14) |
InChIKey | WVIQWFCZZRBQMI-UHFFFAOYSA-N |
SMILES | COC1=C2C(=CC(=C1)C(=O)O)C=CC=N2 |