For research use only. Not for therapeutic Use.
8-Methyl-1,2,3,4-tetrahydroquinolin-4-one(Cat No.:L007406), is a chemical compound. This compound is a derivative of quinoline and belongs to the class of heterocyclic compounds. Its structure consists of a quinoline ring system with an additional methyl group and a carbonyl group. Heterocyclic compounds like this one are vital in medicinal chemistry, where they serve as essential building blocks for drug discovery. Researchers explore various synthetic pathways utilizing these compounds to create diverse molecules, potentially leading to the development of new pharmaceuticals and other applications in the field of organic chemistry.
CAS Number | 36053-94-8 |
Molecular Formula | C10H11NO |
Purity | ≥95% |
IUPAC Name | 8-methyl-2,3-dihydro-1H-quinolin-4-one |
InChI | InChI=1S/C10H11NO/c1-7-3-2-4-8-9(12)5-6-11-10(7)8/h2-4,11H,5-6H2,1H3 |
InChIKey | VZLHOBQCHKAIOM-UHFFFAOYSA-N |
SMILES | CC1=C2C(=CC=C1)C(=O)CCN2 |