For research use only. Not for therapeutic Use.
8-Methyl-3,4-dihydroisoquinolin-1(2H)-one(CAT: L032803) is a heterocyclic compound featuring an isoquinoline core with a methyl substitution at the 8-position. This chemical structure provides a foundation for the study of biologically active molecules, particularly those involving dopamine receptors and CNS-related pathways. Its unique scaffold makes it useful in synthetic organic chemistry as a precursor in the design of pharmacologically relevant agents. Researchers may employ this compound in medicinal chemistry for the development of inhibitors or ligands in drug discovery programs. It is a versatile intermediate in various organic reactions, contributing to advancements in pharmaceutical research.
CAS Number | 1082041-79-9 |
Molecular Formula | C10H11NO |
Purity | ≥95% |
IUPAC Name | 8-methyl-3,4-dihydro-2H-isoquinolin-1-one |
InChI | InChI=1S/C10H11NO/c1-7-3-2-4-8-5-6-11-10(12)9(7)8/h2-4H,5-6H2,1H3,(H,11,12) |
InChIKey | YTAVXUVDTBJJMT-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |