For research use only. Not for therapeutic Use.
8-Methylquinolin-4(1H)-one(Cat No.:L026149)is a high-purity heterocyclic compound commonly used in pharmaceutical and chemical research. This molecule features a quinolinone core with a methyl group at the 8-position, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations, supporting the development of novel therapeutic agents. 8-Methylquinolin-4(1H)-one is ideal for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research efforts.
Catalog Number | L026149 |
CAS Number | 23432-44-2 |
Molecular Formula | C10H9NO |
Purity | ≥95% |
IUPAC Name | 8-methyl-1H-quinolin-4-one |
InChI | InChI=1S/C10H9NO/c1-7-3-2-4-8-9(12)5-6-11-10(7)8/h2-6H,1H3,(H,11,12) |
InChIKey | HTISUYZVEWQIMP-UHFFFAOYSA-N |
SMILES | CC1=C2C(=CC=C1)C(=O)C=CN2 |