For research use only. Not for therapeutic Use.
8-Methylquinoline-5-boronic Acid Pinacol Ester (Cat.No:L004071) is a pivotal compound in the field of chemical synthesis. Its unique boronic acid functionality, combined with a pinacol ester group, imparts versatile reactivity and properties. This compound serves as a valuable building block in the creation of specialized organic molecules with applications in pharmaceutical and chemical research.
Catalog Number | L004071 |
CAS Number | 1366740-47-7 |
Molecular Formula | C16H20BNO2 |
Purity | ≥95% |
IUPAC Name | 8-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
InChI | InChI=1S/C16H20BNO2/c1-11-8-9-13(12-7-6-10-18-14(11)12)17-19-15(2,3)16(4,5)20-17/h6-10H,1-5H3 |
InChIKey | VZGVWEMFQCGKIS-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C=CC=NC3=C(C=C2)C |