For research use only. Not for therapeutic Use.
8-Nitroguanine is a nitrated guanine derivative formed during oxidative and nitrative stress, often used as a biomarker for DNA damage and mutagenesis. This compound plays a crucial role in studying the molecular mechanisms of inflammation, cancer development, and neurodegenerative diseases, where reactive nitrogen species contribute to cellular damage. Its presence in cells can indicate significant genotoxic effects, making it a valuable tool for researchers investigating the links between nitrosative stress and disease progression. 8-Nitroguanine is essential for advancing studies on oxidative stress-related disorders and developing potential therapeutic interventions for mitigating DNA damage.
CAS Number | 168701-80-2 |
Synonyms | 2-Amino-1,9-dihydro-8-nitro-6H-purin-6-one; 2-Amino-1,7-dihydro-8-nitro-6H-purin-6-one; |
Molecular Formula | C5H4N6O3 |
Purity | ≥95% |
Target | NO Synthase |
Storage | -20°C |
IUPAC Name | 2-amino-8-nitro-3,7-dihydropurin-6-one |
InChI | InChI=1S/C5H4N6O3/c6-4-8-2-1(3(12)10-4)7-5(9-2)11(13)14/h(H4,6,7,8,9,10,12) |
InChIKey | IYHJRKNFFYAOGE-UHFFFAOYSA-N |
SMILES | C12=C(NC(=NC1=O)N)N=C(N2)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |