For research use only. Not for therapeutic Use.
8-Nonynoic acid (Cat No.:L007095) is an aliphatic monocarboxylic acid with a nine-carbon chain containing a triple bond between the eighth and ninth carbons. It features a carboxylic acid group at the first carbon position. This compound finds applications in specialty chemical synthesis, and surfactant production, and serves as a building block for other organic compounds. Its unique structure and reactivity make it valuable for research in bioactive molecule studies and other scientific investigations.
| Catalog Number | L007095 |
| CAS Number | 30964-01-3 |
| Molecular Formula | C9H14O2 |
| Purity | ≥95% |
| IUPAC Name | non-8-ynoic acid |
| InChI | InChI=1S/C9H14O2/c1-2-3-4-5-6-7-8-9(10)11/h1H,3-8H2,(H,10,11) |
| InChIKey | NLRIJHGYFNZMGB-UHFFFAOYSA-N |
| SMILES | C#CCCCCCCC(=O)O |
