For research use only. Not for therapeutic Use.
8-Oxabicyclo[3.2.1]octan-3-one(Cat No.:L036820)is a bicyclic organic compound featuring an oxabicyclo ring system with a ketone functional group at the 3-position. This compound is commonly used in organic synthesis and pharmaceutical research as an intermediate for the development of various bioactive molecules and complex molecular structures. Its rigid, three-dimensional framework provides unique reactivity, making it valuable for designing new chemical entities, including potential drug candidates. High purity and stability ensure its utility in advanced research applications, particularly in medicinal chemistry and the synthesis of novel compounds.
CAS Number | 77745-32-5 |
Molecular Formula | C7H10O2 |
Purity | ≥95% |
IUPAC Name | 8-oxabicyclo[3.2.1]octan-3-one |
InChI | InChI=1S/C7H10O2/c8-5-3-6-1-2-7(4-5)9-6/h6-7H,1-4H2 |
InChIKey | XWUJGUIPMCLRBE-UHFFFAOYSA-N |
SMILES | C1CC2CC(=O)CC1O2 |