For research use only. Not for therapeutic Use.
8-Oxo-2′-deoxyguanosine (8-oxo-dG) is a modified nucleoside that results from the oxidative damage of DNA, specifically the guanine base. It is considered a biomarker for oxidative stress and DNA damage because its formation indicates the presence of reactive oxygen species (ROS) that can lead to mutations and cellular dysfunction. Elevated levels of 8-oxo-dG are associated with various diseases, including cancer, neurodegenerative disorders, and aging-related conditions. It is commonly measured in research and clinical studies to assess oxidative stress and its impact on human health.
CAS Number | 88847-89-6 |
Synonyms | 8-Hydroxy-2’-deoxyguanosine; 2’-Deoxy-7,8-dihydro-8-oxo-guanosine; 8-Oxo-7,8-dihydro-2’-deoxyguanosine; 8-Oxo-7,8-dihydrodeoxyguanosine; 8-Oxo-dG; |
Molecular Formula | C10H13N5O5 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3,7-dihydropurine-6,8-dione |
InChI | InChI=1S/C10H13N5O5/c11-9-13-7-6(8(18)14-9)12-10(19)15(7)5-1-3(17)4(2-16)20-5/h3-5,16-17H,1-2H2,(H,12,19)(H3,11,13,14,18)/t3-,4+,5+/m0/s1 |
InChIKey | HCAJQHYUCKICQH-VPENINKCSA-N |
SMILES | C1C(C(OC1N2C3=C(C(=O)N=C(N3)N)NC2=O)CO)O |