For research use only. Not for therapeutic Use.
8-Oxodeoxyguanosine triphosphate (8-oxodGTP)(Cat No.:M118361)is a modified nucleotide used in molecular biology research to study oxidative DNA damage and repair mechanisms. Formed by the oxidation of deoxyguanosine triphosphate (dGTP), it is incorporated into DNA during replication, leading to mutagenesis if not properly repaired. 8-oxodGTP serves as a biomarker for oxidative stress and is crucial in understanding the cellular response to oxidative damage. Its applications extend to cancer research, aging studies, and the development of therapeutic strategies to counteract oxidative DNA damage, highlighting its significance in genomic stability research.
CAS Number | 139307-94-1 |
Synonyms | 8-oxodeoxyguanosine triphosphate |
Molecular Formula | C10H16N5O14P3 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | [[(2R,3S,5R)-5-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
InChI | InChI=1S/C10H16N5O14P3/c11-9-13-7-6(8(17)14-9)12-10(18)15(7)5-1-3(16)4(27-5)2-26-31(22,23)29-32(24,25)28-30(19,20)21/h3-5,16H,1-2H2,(H,12,18)(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,17)/t3-,4+,5+/m0/s1 |
InChIKey | BUZOGVVQWCXXDP-VPENINKCSA-N |
SMILES | C1C(C(OC1N2C3=C(C(=O)NC(=N3)N)NC2=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |