For research use only. Not for therapeutic Use.
8-Prenyldaidzein is a flavonoid compound characterized by a prenyl group at the 8-position of the daidzein structure. This compound is significant in medicinal chemistry due to its potential health benefits, including antioxidant, anti-inflammatory, and anticancer properties. The prenyl group enhances its lipophilicity and biological activity, making it more effective in cellular interactions. Its unique structure allows for further functionalization, making it valuable in the development of novel therapeutic agents and in exploring new applications in nutraceuticals and phytochemistry.
| Catalog Number | M132495 |
| CAS Number | 135384-00-8 |
| Synonyms | 7-hydroxy-3-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Formula | C20H18O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H18O4/c1-12(2)3-8-15-18(22)10-9-16-19(23)17(11-24-20(15)16)13-4-6-14(21)7-5-13/h3-7,9-11,21-22H,8H2,1-2H3 |
| InChIKey | NQKCBBHHFITUFF-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC2=C1OC=C(C2=O)C3=CC=C(C=C3)O)O)C |
