For research use only. Not for therapeutic Use.
(8|A,9S)-6′-Methoxycinchonan-9-amine trihydrochloride(Cat No.:L010852), is a chemical compound used in organic synthesis and pharmaceutical research. It is a cinchonan-9-amine derivative with a methoxy group attached to the 6′ position of the cinchona alkaloid. The trihydrochloride form is a common salt used for stability and handling purposes. This compound serves as a valuable intermediate in the synthesis of various organic molecules and pharmaceutical compounds. Its unique structure makes it suitable for introducing specific functional groups into target molecules.
Catalog Number | L010852 |
CAS Number | 1231763-32-8 |
Molecular Formula | C20H28Cl3N3O |
Purity | ≥95% |
IUPAC Name | (S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanamine;trihydrochloride |
InChI | InChI=1S/C20H25N3O.3ClH/c1-3-13-12-23-9-7-14(13)10-19(23)20(21)16-6-8-22-18-5-4-15(24-2)11-17(16)18;;;/h3-6,8,11,13-14,19-20H,1,7,9-10,12,21H2,2H3;3*1H/t13-,14-,19-,20-;;;/m0.../s1 |
InChIKey | GZXDEKGNTLNSGM-HVHHAJEFSA-N |
SMILES | COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)N.Cl.Cl.Cl |