For research use only. Not for therapeutic Use.
9-(2-Bromoethyl)-9H-carbazol-3-amine (Cat.No:L004160) is a significant compound in organic synthesis. Its unique structure, combining a carbazole scaffold and a bromoethyl group, imparts distinctive reactivity and properties. This compound is employed as a valuable intermediate in the preparation of specialized organic molecules with potential applications in pharmaceutical and chemical research.
Catalog Number | L004160 |
CAS Number | 2442597-58-0 |
Molecular Formula | C14H13BrN2 |
Purity | ≥95% |
IUPAC Name | 9-(2-bromoethyl)carbazol-3-amine |
InChI | InChI=1S/C14H13BrN2/c15-7-8-17-13-4-2-1-3-11(13)12-9-10(16)5-6-14(12)17/h1-6,9H,7-8,16H2 |
InChIKey | PJEQKDDWQSRRAG-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=C(N2CCBr)C=CC(=C3)N |