For research use only. Not for therapeutic Use.
9-(2-Carboxy-2-cyanovinyl)julolidine(Cat No.:R028649)is a specialized organic compound essential in advanced chemical research and development. This molecule, characterized by its carboxy and cyanovinyl functional groups, exhibits unique photophysical properties, making it invaluable for studies in photochemistry and materials science. Its high purity and stability ensure reliable experimental results, particularly in the synthesis of fluorescent probes and dyes. With applications spanning from molecular electronics to biological imaging, 9-(2-Carboxy-2-cyanovinyl)julolidine is a versatile compound that integrates seamlessly into various research protocols, enhancing scientific investigations and technological advancements.
CAS Number | 142978-18-5 |
Synonyms | 1H,5H-Benzo[ij]quinolizine 2-Propenoic Acid Derivative; 2-Carboxy-2-cyanovinyljulolidine; CCVJ |
Molecular Formula | C16H16N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-3-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-2-cyanoprop-2-enoic acid |
InChI | InChI=1S/C16H16N2O2/c17-10-14(16(19)20)9-11-7-12-3-1-5-18-6-2-4-13(8-11)15(12)18/h7-9H,1-6H2,(H,19,20)/b14-9+ |
InChIKey | JXENNHTVELFRHV-NTEUORMPSA-N |
SMILES | C1CC2=CC(=CC3=C2N(C1)CCC3)C=C(C#N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |