For research use only. Not for therapeutic Use.
9-(4′-chloro-[1,1′-biphenyl]-3-yl)-9H-carbazole (Cat.No:L003996) is a crucial compound in materials science and electronics. Its unique structure, fusing a carbazole core with a chlorobiphenyl unit, imparts specialized electronic properties. This compound is employed in the fabrication of organic electronic devices such as OLEDs and organic semiconductors.
Catalog Number | L003996 |
CAS Number | 2148296-04-0 |
Molecular Formula | C24H16ClN |
Purity | ≥95% |
IUPAC Name | 9-[3-(4-chlorophenyl)phenyl]carbazole |
InChI | InChI=1S/C24H16ClN/c25-19-14-12-17(13-15-19)18-6-5-7-20(16-18)26-23-10-3-1-8-21(23)22-9-2-4-11-24(22)26/h1-16H |
InChIKey | GPSANGMVXUUILB-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=CC(=C4)C5=CC=C(C=C5)Cl |