For research use only. Not for therapeutic Use.
9-(4-Fluorophenyl)-9H-carbazole (Cat.No:L003744) is a vital chemical compound with diverse applications. Its unique structure, comprising a fluorophenyl group fused to a carbazole ring system, imparts significant electronic and optical properties. This compound finds use in the synthesis of organic semiconductors, making it invaluable in the development of optoelectronic devices like OLEDs and solar cells. Its significance in materials science and electronics underscores its importance in advancing modern technology and innovation.
CAS Number | 57103-14-7 |
Molecular Formula | C18H12FN |
Purity | ≥95% |
IUPAC Name | 9-(4-fluorophenyl)carbazole |
InChI | InChI=1S/C18H12FN/c19-13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-12H |
InChIKey | VCYZFGQPKNTPFI-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=C(C=C4)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |