For research use only. Not for therapeutic Use.
9-Amino-NeuAc (CAT: I040930) is a derivative of sialic acid, a monosaccharide commonly found on the surface of glycoproteins and glycolipids. The amino group at the 9-position makes it a functionalized version of sialic acid, allowing for easier conjugation with other molecules, such as proteins or nanoparticles. It plays a crucial role in glycan recognition and can be involved in studies related to cell signaling, immune response modulation, and viral infections, where sialic acid is a key factor in the interaction between pathogens and host cells. 9-Amino-NeuAc is particularly relevant for research in Glycobiology, Material Chemistry, and infection-related studies, where sialic acid interactions are significant.
| CAS Number | 153232-60-1 |
| Synonyms | (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-2,4-dihydroxyoxane-2-carboxylic acid |
| Molecular Formula | C11H20N2O8 |
| Purity | ≥95% |
| IUPAC Name | (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-amino-1,2-dihydroxypropyl]-2,4-dihydroxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C11H20N2O8/c1-4(14)13-7-5(15)2-11(20,10(18)19)21-9(7)8(17)6(16)3-12/h5-9,15-17,20H,2-3,12H2,1H3,(H,13,14)(H,18,19)/t5-,6+,7+,8+,9+,11-/m0/s1 |
| InChIKey | PSFLJKJWZHEYMD-PFQGKNLYSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](C[C@](O[C@H]1[C@@H]([C@@H](CN)O)O)(C(=O)O)O)O |
