For research use only. Not for therapeutic Use.
9-Aminoacridine（Cat No.:R053827）is a synthetic aromatic compound with strong fluorescence properties, often used as a DNA intercalator in molecular biology research. It has been widely employed in studies related to nucleic acid binding, as it can intercalate between base pairs of DNA and RNA, making it useful in assays like gel electrophoresis and fluorescence microscopy. In addition, 9-Aminoacridine has been explored for its potential anti-cancer and anti-microbial effects, as well as its ability to induce DNA damage, which may contribute to its biological activities. It serves as a key tool in cell biology and genetics research.
| Catalog Number | R053827 |
| CAS Number | 90-45-9 |
| Synonyms | 10-Amino-5-azaanthracene; 9-Aminoacridine; 9AA; Aminacrin; Aminacrine; Izoacridina; Monacrin; NSC 13000; NSC 28747 |
| Molecular Formula | C₁₃H₁₀N₂ |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | 3 years -20C powder |
| IUPAC Name | acridin-9-amine |
| InChI | InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15) |
| InChIKey | XJGFWWJLMVZSIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)N |
