For research use only. Not for therapeutic Use.
9-Anthracenemethanol(Cat No.:M047106)is a valuable organic compound widely used in pharmaceutical, chemical, and materials research. Featuring an anthracene ring system attached to a methanol group, this compound is crucial for the synthesis of complex molecules and the development of advanced materials. Its unique aromatic structure makes it a key intermediate in various photochemical reactions and in the production of fluorescent dyes. 9-Anthracenemethanol supports high-precision research, contributing to advancements in organic synthesis, photochemistry, and the development of innovative materials in scientific investigations.
CAS Number | 1468-95-7 |
Molecular Formula | C15H12O |
Purity | ≥95% |
IUPAC Name | anthracen-9-ylmethanol |
InChI | InChI=1S/C15H12O/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9,16H,10H2 |
InChIKey | JCJNNHDZTLRSGN-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2CO |