For research use only. Not for therapeutic Use.
9-ANTHRYLDIAZOMETHANE (Cat.No:M055831) is a chemical compound featuring an anthryl group attached to diazomethane. It is used as a reagent in organic synthesis to introduce the anthryl functionality into various molecules. This compound can be valuable in research and laboratory settings for creating anthracene derivatives with specific properties.
Catalog Number | M055831 |
CAS Number | 10401-59-9 |
Molecular Formula | C15H10N2 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | 9-(diazomethyl)anthracene |
InChI | InChI=1S/C15H10N2/c16-17-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-10H |
InChIKey | XXDVOJKRZBNPFN-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C3C=CC=CC3=C2C=[N+]=[N-] |