For research use only. Not for therapeutic Use.
9-Benzylcarbazole(Cat No.:M078945)is an aromatic compound featuring a carbazole core with a benzyl group attached to the nitrogen atom. It is widely used in organic synthesis, materials science, and pharmaceutical research. This compound serves as a key intermediate in the development of organic semiconductors, light-emitting materials, and potential drug candidates. Its structure provides stability and unique electronic properties, making it valuable in the synthesis of advanced materials, including OLEDs and conductive polymers. Researchers in these fields utilize 9-Benzylcarbazole to explore innovative applications in electronics and medicinal chemistry.
CAS Number | 19402-87-0 |
Molecular Formula | C19H15N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 9-benzylcarbazole |
InChI | InChI=1S/C19H15N/c1-2-8-15(9-3-1)14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13H,14H2 |
InChIKey | HBAKJBGOHINNQM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C4=CC=CC=C42 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |