For research use only. Not for therapeutic Use.
9-(Bromomethyl)acridine is an aromatic compound featuring an acridine backbone with a bromomethyl substituent at the 9-position. This compound is significant in organic synthesis and medicinal chemistry due to its potential applications as a building block for creating bioactive molecules. The bromomethyl group enhances its reactivity, allowing for further functionalization and modification. It is often explored for its biological activities, including antitumor and antimicrobial properties, making it valuable in the development of novel therapeutic agents and chemical probes.
CAS Number | 1556-34-9 |
Molecular Formula | C14H10BrN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 9-(bromomethyl)acridine |
InChI | InChI=1S/C14H10BrN/c15-9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2 |
InChIKey | MZFYKBHQWLWIBI-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |