For research use only. Not for therapeutic Use.
9-Bromophenanthrene is an aromatic organic compound derived from phenanthrene, with a bromine atom substituted at the 9-position of the phenanthrene ring. This compound is used as a key intermediate in organic synthesis, particularly in the creation of polyaromatic compounds, pharmaceuticals, and advanced materials. Its bromine group allows for versatile chemical transformations, including cross-coupling reactions such as Suzuki or Heck coupling, making it valuable for constructing complex molecular architectures. Researchers use 9-Bromophenanthrene in the development of new materials, drug candidates, and studies involving organic electronic devices and photophysical properties.
CAS Number | 573-17-1 |
Synonyms | 9-Phenanthryl Bromide; NSC 400708 |
Molecular Formula | C14H9Br |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 9-bromophenanthrene |
InChI | InChI=1S/C14H9Br/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9H |
InChIKey | RSQXKVWKJVUZDG-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=C(C3=CC=CC=C23)Br |