For research use only. Not for therapeutic Use.
9-Deazaguanine is an analog of guanine that acts as an inhibitor of purine nucleoside phosphorylase (PNP; K<sub>d</sub> = 160 nM). Inhibitors of PNP are used to control T cell proliferation, particularly in T cell cancers, autoimmune diseases, and tissue transplant rejection.
| Catalog Number | R009550 |
| CAS Number | 65996-58-9 |
| Synonyms | 2-Amino-1,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one; NSC 344522; |
| Molecular Formula | C6H6N4O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-amino-1,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| InChI | InChI=1S/C6H6N4O/c7-6-9-3-1-2-8-4(3)5(11)10-6/h1-2,8H,(H3,7,9,10,11) |
| InChIKey | FFYPRJYSJODFFD-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1NC(=NC2=O)N |
