For research use only. Not for therapeutic Use.
9-Ethyl Adenine (Cat No.:R016617) is a synthetic derivative of adenine, a purine nucleobase found in DNA and RNA. By introducing an ethyl group at the N9 position, this compound alters the base’s chemical and biological properties, making it useful in biochemical and pharmacological research. It has been studied for its potential antiviral and anticancer activities, as well as its role in nucleic acid analog development. 9-Ethyl adenine is also used to investigate nucleotide interactions, enzyme mechanisms, and receptor binding in purinergic signaling pathways.
| CAS Number | 2715-68-6 |
| Synonyms | 9-Ethyladenine; NSC 14580; |
| Molecular Formula | C7H9N5 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | Room temperature |
| IUPAC Name | 9-ethylpurin-6-amine |
| InChI | InChI=1S/C7H9N5/c1-2-12-4-11-5-6(8)9-3-10-7(5)12/h3-4H,2H2,1H3,(H2,8,9,10) |
| InChIKey | MUIPLRMGAXZWSQ-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1N=CN=C2N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
