For research use only. Not for therapeutic Use.
9-Ethynyl-anthracene is a substituted anthracene derivative featuring an ethynyl group at the 9-position, which enhances its electronic and optical properties. This compound is of significant interest in materials science, particularly in the development of organic semiconductors and light-emitting devices. Its unique structure allows for improved charge transport and photoluminescence, making it suitable for applications in organic photovoltaics and OLEDs. Ongoing research aims to explore its potential in nanotechnology and optoelectronics, contributing to advancements in next-generation electronic materials.
| CAS Number | 13752-40-4 |
| Synonyms | 9-ETHYNYL-ANTHRACENE |
| Molecular Formula | C16H10 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 9-ethynylanthracene |
| InChI | InChI=1S/C16H10/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h1,3-11H |
| InChIKey | WSZBYXQREMPYLP-UHFFFAOYSA-N |
| SMILES | C#CC1=C2C=CC=CC2=CC3=CC=CC=C31 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
