For research use only. Not for therapeutic Use.
9-Hydroxycalabaxanthone（Cat No.:R008608）is a natural xanthone compound isolated from the Garcinia species, known for its potential therapeutic properties. This compound has attracted interest for its antioxidant, anti-inflammatory, and anticancer activities, making it a valuable subject in pharmacological research. Studies suggest it may inhibit cancer cell proliferation and protect cells from oxidative stress, contributing to its potential in cancer and chronic disease research. The bioactive properties of 9-Hydroxycalabaxanthone highlight its promise in developing natural health products and as a basis for new drugs targeting inflammation and oxidative damage.
| Catalog Number | R008608 |
| CAS Number | 35349-68-9 |
| Molecular Formula | C24H24O6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5,9-dihydroxy-8-methoxy-2,2-dimethyl-7-(3-methylbut-2-enyl)pyrano[3,2-b]xanthen-6-one |
| InChI | InChI=1S/C24H24O6/c1-12(2)6-7-14-19-17(10-15(25)23(14)28-5)29-18-11-16-13(8-9-24(3,4)30-16)21(26)20(18)22(19)27/h6,8-11,25-26H,7H2,1-5H3 |
| InChIKey | HQWHKELJHUFLGD-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(C4=C(C=C3O2)OC(C=C4)(C)C)O)O)OC)C |
